C8H17NO2S — CID 88802141
(2S)-2-[[(2S)-butan-2-yl]amino]-4-sulfanylbutanoic acid (PubChem CID 88802141) has the molecular formula C8H17NO2S and a molecular weight of 191.30 g/mol. Its IUPAC name is (2S)-2-[[(2S)-butan-2-yl]amino]-4-sulfanylbutanoic acid.
| Compound Name | (2S)-2-[[(2S)-butan-2-yl]amino]-4-sulfanylbutanoic acid |
|---|---|
| PubChem CID | 88802141 |
| Molecular Formula | C8H17NO2S |
| Molecular Weight | 191.30 g/mol |
| Exact Mass | 191.10 |
| IUPAC Name | (2S)-2-[[(2S)-butan-2-yl]amino]-4-sulfanylbutanoic acid |
| SMILES | CC[C@H](C)N[C@@H](CCS)C(=O)O |
| InChI | InChI=1S/C8H17NO2S/c1-3-6(2)9-7(4-5-12)8(10)11/h6-7,9,12H,3-5H2,1-2H3,(H,10,11)/t6-,7-/m0/s1 |
| InChIKey | MYRODVOOOGTAIE-BQBZGAKWSA-N |
| XLogP | 1.15 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.30 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|