C10H16N6O4S2 — CID 139244647
2-[[6-[(1-carboxy-3-sulfanylpropyl)amino]-1,2,4,5-tetrazin-3-yl]amino]-4-sulfanylbutanoic acid (PubChem CID 139244647) has the molecular formula C10H16N6O4S2 and a molecular weight of 348.41 g/mol. Its IUPAC name is 2-[[6-[(1-carboxy-3-sulfanylpropyl)amino]-1,2,4,5-tetrazin-3-yl]amino]-4-sulfanylbutanoic acid.
| Compound Name | 2-[[6-[(1-carboxy-3-sulfanylpropyl)amino]-1,2,4,5-tetrazin-3-yl]amino]-4-sulfanylbutanoic acid |
|---|---|
| PubChem CID | 139244647 |
| Molecular Formula | C10H16N6O4S2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 2-[[6-[(1-carboxy-3-sulfanylpropyl)amino]-1,2,4,5-tetrazin-3-yl]amino]-4-sulfanylbutanoic acid |
| SMILES | O=C(O)C(CCS)Nc1nnc(NC(CCS)C(=O)O)nn1 |
| InChI | InChI=1S/C10H16N6O4S2/c17-7(18)5(1-3-21)11-9-13-15-10(16-14-9)12-6(2-4-22)8(19)20/h5-6,21-22H,1-4H2,(H,17,18)(H,19,20)(H,11,13,14)(H,12,15,16) |
| InChIKey | LKQNPHJUQVPYHX-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 150.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|