C8H10N4O3S — CID 44546303
(2R)-4-nitrososulfanyl-2-(pyrimidin-2-ylamino)butanoic acid (PubChem CID 44546303) has the molecular formula C8H10N4O3S and a molecular weight of 242.26 g/mol. Its IUPAC name is (2R)-4-nitrososulfanyl-2-(pyrimidin-2-ylamino)butanoic acid.
| Compound Name | (2R)-4-nitrososulfanyl-2-(pyrimidin-2-ylamino)butanoic acid |
|---|---|
| PubChem CID | 44546303 |
| Molecular Formula | C8H10N4O3S |
| Molecular Weight | 242.26 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | (2R)-4-nitrososulfanyl-2-(pyrimidin-2-ylamino)butanoic acid |
| SMILES | O=NSCC[C@@H](Nc1ncccn1)C(=O)O |
| InChI | InChI=1S/C8H10N4O3S/c13-7(14)6(2-5-16-12-15)11-8-9-3-1-4-10-8/h1,3-4,6H,2,5H2,(H,13,14)(H,9,10,11)/t6-/m1/s1 |
| InChIKey | QXDCFCCFSUUASY-ZCFIWIBFSA-N |
| XLogP | 1.15 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.26 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|