C9H12ClN3O2S — CID 129497577
(2R)-2-[(3-chloropyrazin-2-yl)amino]-4-methylsulfanylbutanoic acid (PubChem CID 129497577) has the molecular formula C9H12ClN3O2S and a molecular weight of 261.73 g/mol. Its IUPAC name is (2R)-2-[(3-chloropyrazin-2-yl)amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2R)-2-[(3-chloropyrazin-2-yl)amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 129497577 |
| Molecular Formula | C9H12ClN3O2S |
| Molecular Weight | 261.73 g/mol |
| Exact Mass | 261.03 |
| IUPAC Name | (2R)-2-[(3-chloropyrazin-2-yl)amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@@H](Nc1nccnc1Cl)C(=O)O |
| InChI | InChI=1S/C9H12ClN3O2S/c1-16-5-2-6(9(14)15)13-8-7(10)11-3-4-12-8/h3-4,6H,2,5H2,1H3,(H,12,13)(H,14,15)/t6-/m1/s1 |
| InChIKey | ONFWJVJESCNLCB-ZCFIWIBFSA-N |
| XLogP | 1.75 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.73 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |