C10H14N6O2S — CID 71826393
(2S)-2-[(2-amino-7H-purin-6-yl)amino]-4-methylsulfanylbutanoic acid (PubChem CID 71826393) has the molecular formula C10H14N6O2S and a molecular weight of 282.33 g/mol. Its IUPAC name is (2S)-2-[(2-amino-7H-purin-6-yl)amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[(2-amino-7H-purin-6-yl)amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 71826393 |
| Molecular Formula | C10H14N6O2S |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | (2S)-2-[(2-amino-7H-purin-6-yl)amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@H](Nc1nc(N)nc2nc[nH]c12)C(=O)O |
| InChI | InChI=1S/C10H14N6O2S/c1-19-3-2-5(9(17)18)14-8-6-7(13-4-12-6)15-10(11)16-8/h4-5H,2-3H2,1H3,(H,17,18)(H4,11,12,13,14,15,16)/t5-/m0/s1 |
| InChIKey | VZBGIOHZZDBMQO-YFKPBYRVSA-N |
| XLogP | 0.55 |
| TPSA | 129.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |