C10H18N6O2S — CID 44545911
(2R)-2-[[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]amino]-3-sulfanylpropanoic acid (PubChem CID 44545911) has the molecular formula C10H18N6O2S and a molecular weight of 286.36 g/mol. Its IUPAC name is (2R)-2-[[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]amino]-3-sulfanylpropanoic acid.
| Compound Name | (2R)-2-[[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 44545911 |
| Molecular Formula | C10H18N6O2S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | (2R)-2-[[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]amino]-3-sulfanylpropanoic acid |
| SMILES | CN(C)c1nc(N[C@@H](CS)C(=O)O)nc(N(C)C)n1 |
| InChI | InChI=1S/C10H18N6O2S/c1-15(2)9-12-8(11-6(5-19)7(17)18)13-10(14-9)16(3)4/h6,19H,5H2,1-4H3,(H,17,18)(H,11,12,13,14)/t6-/m0/s1 |
| InChIKey | RWLMADSQKZHXLQ-LURJTMIESA-N |
| XLogP | -0.20 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|