C6H14N2O2S — CID 23341045
2-(2-aminopropylamino)-3-sulfanylpropanoic acid (PubChem CID 23341045) has the molecular formula C6H14N2O2S and a molecular weight of 178.26 g/mol. Its IUPAC name is 2-(2-aminopropylamino)-3-sulfanylpropanoic acid.
| Compound Name | 2-(2-aminopropylamino)-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 23341045 |
| Molecular Formula | C6H14N2O2S |
| Molecular Weight | 178.26 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | 2-(2-aminopropylamino)-3-sulfanylpropanoic acid |
| SMILES | CC(N)CNC(CS)C(=O)O |
| InChI | InChI=1S/C6H14N2O2S/c1-4(7)2-8-5(3-11)6(9)10/h4-5,8,11H,2-3,7H2,1H3,(H,9,10) |
| InChIKey | DZUAGYSQGFUKNW-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.26 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|