C9H20N2O2S — CID 139673452
(2S)-2-[[(2R)-2-amino-3-sulfanylpropyl]amino]hexanoic acid (PubChem CID 139673452) has the molecular formula C9H20N2O2S and a molecular weight of 220.34 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-amino-3-sulfanylpropyl]amino]hexanoic acid.
| Compound Name | (2S)-2-[[(2R)-2-amino-3-sulfanylpropyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 139673452 |
| Molecular Formula | C9H20N2O2S |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | (2S)-2-[[(2R)-2-amino-3-sulfanylpropyl]amino]hexanoic acid |
| SMILES | CCCC[C@H](NC[C@@H](N)CS)C(=O)O |
| InChI | InChI=1S/C9H20N2O2S/c1-2-3-4-8(9(12)13)11-5-7(10)6-14/h7-8,11,14H,2-6,10H2,1H3,(H,12,13)/t7-,8+/m1/s1 |
| InChIKey | BGQOXSVYGYULMG-SFYZADRCSA-N |
| XLogP | 0.48 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|