(2S)-6-amino-2-(2-ethylhexylamino)hexanoic acid;propanoic acid

C17H36N2O4 — CID 162157339

IUPAC(2S)-6-amino-2-(2-ethylhexylamino)hexanoic acid;propanoic acid
SMILESCCC(=O)O.CCCCC(CC)CN[C@@H](CCCCN)C(=O)O
InChIInChI=1S/C14H30N2O2.C3H6O2/c1-3-5-8-12(4-2)11-16-13(14(17)18)9-6-7-10-15;1-2-3(4)5/h12-13,16H,3-11,15H2,1-2H3,(H,17,18);2H2,1H3,(H,4,5)/t12?,13-;/m0./s1
InChIKeyZLZUNFOGGSKVFO-ZEDZUCNESA-N
MW332.49 g/mol
LogP2.86
Rot. Bonds13

About (2S)-6-amino-2-(2-ethylhexylamino)hexanoic acid;propanoic acid

(2S)-6-amino-2-(2-ethylhexylamino)hexanoic acid;propanoic acid (PubChem CID 162157339) has the molecular formula C17H36N2O4 and a molecular weight of 332.49 g/mol. Its IUPAC name is (2S)-6-amino-2-(2-ethylhexylamino)hexanoic acid;propanoic acid.

Molecular Properties

Compound Name(2S)-6-amino-2-(2-ethylhexylamino)hexanoic acid;propanoic acid
PubChem CID162157339
Molecular FormulaC17H36N2O4
Molecular Weight332.49 g/mol
Exact Mass332.27
IUPAC Name(2S)-6-amino-2-(2-ethylhexylamino)hexanoic acid;propanoic acid
SMILESCCC(=O)O.CCCCC(CC)CN[C@@H](CCCCN)C(=O)O
InChIInChI=1S/C14H30N2O2.C3H6O2/c1-3-5-8-12(4-2)11-16-13(14(17)18)9-6-7-10-15;1-2-3(4)5/h12-13,16H,3-11,15H2,1-2H3,(H,17,18);2H2,1H3,(H,4,5)/t12?,13-;/m0./s1
InChIKeyZLZUNFOGGSKVFO-ZEDZUCNESA-N
XLogP2.86
TPSA112.65 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds13
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500332.49
LogP ≤ 52.86
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze (2S)-6-amino-2-(2-ethylhexylamino)hexanoic acid;propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-6-amino-2-(2-ethylhexylamino)hexanoic acid;propanoic acid?
The IUPAC name of (2S)-6-amino-2-(2-ethylhexylamino)hexanoic acid;propanoic acid (CID 162157339) is (2S)-6-amino-2-(2-ethylhexylamino)hexanoic acid;propanoic acid.
What is the SMILES notation for (2S)-6-amino-2-(2-ethylhexylamino)hexanoic acid;propanoic acid?
The canonical SMILES for (2S)-6-amino-2-(2-ethylhexylamino)hexanoic acid;propanoic acid is CCC(=O)O.CCCCC(CC)CN[C@@H](CCCCN)C(=O)O.
What is the InChIKey of (2S)-6-amino-2-(2-ethylhexylamino)hexanoic acid;propanoic acid?
The InChIKey is ZLZUNFOGGSKVFO-ZEDZUCNESA-N. The full InChI is InChI=1S/C14H30N2O2.C3H6O2/c1-3-5-8-12(4-2)11-16-13(14(17)18)9-6-7-10-15;1-2-3(4)5/h12-13,16H,3-11,15H2,1-2H3,(H,17,18);2H2,1H3,(H,4,5)/t12?,13-;/m0./s1.
What are the key properties of (2S)-6-amino-2-(2-ethylhexylamino)hexanoic acid;propanoic acid?
(2S)-6-amino-2-(2-ethylhexylamino)hexanoic acid;propanoic acid has a molecular weight of 332.49 g/mol, XLogP of 2.86, 13 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-6-amino-2-(2-ethylhexylamino)hexanoic acid;propanoic acid is sourced from PubChem (CID 162157339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).