C17H36N2O4 — CID 162157339
(2S)-6-amino-2-(2-ethylhexylamino)hexanoic acid;propanoic acid (PubChem CID 162157339) has the molecular formula C17H36N2O4 and a molecular weight of 332.49 g/mol. Its IUPAC name is (2S)-6-amino-2-(2-ethylhexylamino)hexanoic acid;propanoic acid.
| Compound Name | (2S)-6-amino-2-(2-ethylhexylamino)hexanoic acid;propanoic acid |
|---|---|
| PubChem CID | 162157339 |
| Molecular Formula | C17H36N2O4 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.27 |
| IUPAC Name | (2S)-6-amino-2-(2-ethylhexylamino)hexanoic acid;propanoic acid |
| SMILES | CCC(=O)O.CCCCC(CC)CN[C@@H](CCCCN)C(=O)O |
| InChI | InChI=1S/C14H30N2O2.C3H6O2/c1-3-5-8-12(4-2)11-16-13(14(17)18)9-6-7-10-15;1-2-3(4)5/h12-13,16H,3-11,15H2,1-2H3,(H,17,18);2H2,1H3,(H,4,5)/t12?,13-;/m0./s1 |
| InChIKey | ZLZUNFOGGSKVFO-ZEDZUCNESA-N |
| XLogP | 2.86 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|