C11H20N2O7S4 — CID 161255166
(2R)-2-[(2-amino-3-oxo-4-sulfanylbutyl)amino]-3-sulfanylpropanoic acid;2,3-bis(sulfanyl)butanedioic acid (PubChem CID 161255166) has the molecular formula C11H20N2O7S4 and a molecular weight of 420.56 g/mol. Its IUPAC name is (2R)-2-[(2-amino-3-oxo-4-sulfanylbutyl)amino]-3-sulfanylpropanoic acid;2,3-bis(sulfanyl)butanedioic acid.
| Compound Name | (2R)-2-[(2-amino-3-oxo-4-sulfanylbutyl)amino]-3-sulfanylpropanoic acid;2,3-bis(sulfanyl)butanedioic acid |
|---|---|
| PubChem CID | 161255166 |
| Molecular Formula | C11H20N2O7S4 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.02 |
| IUPAC Name | (2R)-2-[(2-amino-3-oxo-4-sulfanylbutyl)amino]-3-sulfanylpropanoic acid;2,3-bis(sulfanyl)butanedioic acid |
| SMILES | NC(CN[C@@H](CS)C(=O)O)C(=O)CS.O=C(O)C(S)C(S)C(=O)O |
| InChI | InChI=1S/C7H14N2O3S2.C4H6O4S2/c8-4(6(10)3-14)1-9-5(2-13)7(11)12;5-3(6)1(9)2(10)4(7)8/h4-5,9,13-14H,1-3,8H2,(H,11,12);1-2,9-10H,(H,5,6)(H,7,8)/t4?,5-;/m0./s1 |
| InChIKey | VBUULEZJSKCPNA-YKXIHYLHSA-N |
| XLogP | -1.46 |
| TPSA | 167.02 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|