C9H16N2O5S — CID 118368268
2-amino-6-[(1-carboxy-2-sulfanylethyl)amino]-5-oxohexanoic acid (PubChem CID 118368268) has the molecular formula C9H16N2O5S and a molecular weight of 264.30 g/mol. Its IUPAC name is 2-amino-6-[(1-carboxy-2-sulfanylethyl)amino]-5-oxohexanoic acid.
| Compound Name | 2-amino-6-[(1-carboxy-2-sulfanylethyl)amino]-5-oxohexanoic acid |
|---|---|
| PubChem CID | 118368268 |
| Molecular Formula | C9H16N2O5S |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 2-amino-6-[(1-carboxy-2-sulfanylethyl)amino]-5-oxohexanoic acid |
| SMILES | NC(CCC(=O)CNC(CS)C(=O)O)C(=O)O |
| InChI | InChI=1S/C9H16N2O5S/c10-6(8(13)14)2-1-5(12)3-11-7(4-17)9(15)16/h6-7,11,17H,1-4,10H2,(H,13,14)(H,15,16) |
| InChIKey | XRDFWGOSHJTHTR-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|