C9H17N3O4S — CID 121295230
(2R)-2-[[(3S)-3,6-diamino-2,6-dioxohexyl]amino]-3-sulfanylpropanoic acid (PubChem CID 121295230) has the molecular formula C9H17N3O4S and a molecular weight of 263.32 g/mol. Its IUPAC name is (2R)-2-[[(3S)-3,6-diamino-2,6-dioxohexyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | (2R)-2-[[(3S)-3,6-diamino-2,6-dioxohexyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 121295230 |
| Molecular Formula | C9H17N3O4S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | (2R)-2-[[(3S)-3,6-diamino-2,6-dioxohexyl]amino]-3-sulfanylpropanoic acid |
| SMILES | NC(=O)CC[C@H](N)C(=O)CN[C@@H](CS)C(=O)O |
| InChI | InChI=1S/C9H17N3O4S/c10-5(1-2-8(11)14)7(13)3-12-6(4-17)9(15)16/h5-6,12,17H,1-4,10H2,(H2,11,14)(H,15,16)/t5-,6-/m0/s1 |
| InChIKey | VLFNVIPLMPILJV-WDSKDSINSA-N |
| XLogP | -1.88 |
| TPSA | 135.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|