C7H16ClNO2S — CID 87312397
(2S)-2-(2-methylpropylamino)-3-sulfanylpropanoic acid;hydrochloride (PubChem CID 87312397) has the molecular formula C7H16ClNO2S and a molecular weight of 213.73 g/mol. Its IUPAC name is (2S)-2-(2-methylpropylamino)-3-sulfanylpropanoic acid;hydrochloride.
| Compound Name | (2S)-2-(2-methylpropylamino)-3-sulfanylpropanoic acid;hydrochloride |
|---|---|
| PubChem CID | 87312397 |
| Molecular Formula | C7H16ClNO2S |
| Molecular Weight | 213.73 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | (2S)-2-(2-methylpropylamino)-3-sulfanylpropanoic acid;hydrochloride |
| SMILES | CC(C)CN[C@H](CS)C(=O)O.Cl |
| InChI | InChI=1S/C7H15NO2S.ClH/c1-5(2)3-8-6(4-11)7(9)10;/h5-6,8,11H,3-4H2,1-2H3,(H,9,10);1H/t6-;/m1./s1 |
| InChIKey | JWDXYCBDEFOYIG-FYZOBXCZSA-N |
| XLogP | 1.04 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.73 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|