C6H12N2O5S4 — CID 91020813
(2R)-2-[[[(1R)-1-carboxy-2-sulfanylethyl]amino]sulfanyloxysulfanylamino]-3-sulfanylpropanoic acid (PubChem CID 91020813) has the molecular formula C6H12N2O5S4 and a molecular weight of 320.44 g/mol. Its IUPAC name is (2R)-2-[[[(1R)-1-carboxy-2-sulfanylethyl]amino]sulfanyloxysulfanylamino]-3-sulfanylpropanoic acid.
| Compound Name | (2R)-2-[[[(1R)-1-carboxy-2-sulfanylethyl]amino]sulfanyloxysulfanylamino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 91020813 |
| Molecular Formula | C6H12N2O5S4 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 319.96 |
| IUPAC Name | (2R)-2-[[[(1R)-1-carboxy-2-sulfanylethyl]amino]sulfanyloxysulfanylamino]-3-sulfanylpropanoic acid |
| SMILES | O=C(O)[C@H](CS)NSOSN[C@@H](CS)C(=O)O |
| InChI | InChI=1S/C6H12N2O5S4/c9-5(10)3(1-14)7-16-13-17-8-4(2-15)6(11)12/h3-4,7-8,14-15H,1-2H2,(H,9,10)(H,11,12)/t3-,4-/m0/s1 |
| InChIKey | GSLMEDUXYZBMQY-IMJSIDKUSA-N |
| XLogP | 0.07 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|