C5H11NO2S3 — CID 87989318
2-[(ethyldisulfanyl)amino]-3-sulfanylpropanoic acid (PubChem CID 87989318) has the molecular formula C5H11NO2S3 and a molecular weight of 213.35 g/mol. Its IUPAC name is 2-[(ethyldisulfanyl)amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[(ethyldisulfanyl)amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 87989318 |
| Molecular Formula | C5H11NO2S3 |
| Molecular Weight | 213.35 g/mol |
| Exact Mass | 213.00 |
| IUPAC Name | 2-[(ethyldisulfanyl)amino]-3-sulfanylpropanoic acid |
| SMILES | CCSSNC(CS)C(=O)O |
| InChI | InChI=1S/C5H11NO2S3/c1-2-10-11-6-4(3-9)5(7)8/h4,6,9H,2-3H2,1H3,(H,7,8) |
| InChIKey | CVXSISNUGNZBKD-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.35 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|