C11H22N4O3S2 — CID 175796240
(2R)-2-[[(2R)-2-amino-3-(4-methylpiperazin-1-yl)-3-oxopropyl]sulfanylamino]-3-sulfanylpropanoic acid (PubChem CID 175796240) has the molecular formula C11H22N4O3S2 and a molecular weight of 322.46 g/mol. Its IUPAC name is (2R)-2-[[(2R)-2-amino-3-(4-methylpiperazin-1-yl)-3-oxopropyl]sulfanylamino]-3-sulfanylpropanoic acid.
| Compound Name | (2R)-2-[[(2R)-2-amino-3-(4-methylpiperazin-1-yl)-3-oxopropyl]sulfanylamino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 175796240 |
| Molecular Formula | C11H22N4O3S2 |
| Molecular Weight | 322.46 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | (2R)-2-[[(2R)-2-amino-3-(4-methylpiperazin-1-yl)-3-oxopropyl]sulfanylamino]-3-sulfanylpropanoic acid |
| SMILES | CN1CCN(C(=O)[C@@H](N)CSN[C@@H](CS)C(=O)O)CC1 |
| InChI | InChI=1S/C11H22N4O3S2/c1-14-2-4-15(5-3-14)10(16)8(12)7-20-13-9(6-19)11(17)18/h8-9,13,19H,2-7,12H2,1H3,(H,17,18)/t8-,9-/m0/s1 |
| InChIKey | XDDYLBNLMSKHCZ-IUCAKERBSA-N |
| XLogP | -1.29 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.46 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|