About bis((2R)-2-[5-(4-methylpiperazin-1-yl)pentanoylamino]-3-sulfanylpropanoic acid);hydrobromide
bis((2R)-2-[5-(4-methylpiperazin-1-yl)pentanoylamino]-3-sulfanylpropanoic acid);hydrobromide (PubChem CID 24952539) has the molecular formula C26H51BrN6O6S2
and a molecular weight of 687.77 g/mol. Its IUPAC name is bis((2R)-2-[5-(4-methylpiperazin-1-yl)pentanoylamino]-3-sulfanylpropanoic acid);hydrobromide.
Molecular Properties
| Compound Name | bis((2R)-2-[5-(4-methylpiperazin-1-yl)pentanoylamino]-3-sulfanylpropanoic acid);hydrobromide |
| PubChem CID | 24952539 |
| Molecular Formula | C26H51BrN6O6S2 |
| Molecular Weight | 687.77 g/mol |
| Exact Mass | 686.25 |
| IUPAC Name | bis((2R)-2-[5-(4-methylpiperazin-1-yl)pentanoylamino]-3-sulfanylpropanoic acid);hydrobromide |
| SMILES | Br.CN1CCN(CCCCC(=O)N[C@@H](CS)C(=O)O)CC1.CN1CCN(CCCCC(=O)N[C@@H](CS)C(=O)O)CC1 |
| InChI | InChI=1S/2C13H25N3O3S.BrH/c2*1-15-6-8-16(9-7-15)5-3-2-4-12(17)14-11(10-20)13(18)19;/h2*11,20H,2-10H2,1H3,(H,14,17)(H,18,19);1H/t2*11-;/m00./s1 |
| InChIKey | XYHILFGWSXSRDN-ISAZSYCMSA-N |
| XLogP | 0.38 |
| TPSA | 145.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 687.77 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze bis((2R)-2-[5-(4-methylpiperazin-1-yl)pentanoylamino]-3-sulfanylpropanoic acid);hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis((2R)-2-[5-(4-methylpiperazin-1-yl)pentanoylamino]-3-sulfanylpropanoic acid);hydrobromide?
The IUPAC name of bis((2R)-2-[5-(4-methylpiperazin-1-yl)pentanoylamino]-3-sulfanylpropanoic acid);hydrobromide (CID 24952539) is bis((2R)-2-[5-(4-methylpiperazin-1-yl)pentanoylamino]-3-sulfanylpropanoic acid);hydrobromide.
What is the SMILES notation for bis((2R)-2-[5-(4-methylpiperazin-1-yl)pentanoylamino]-3-sulfanylpropanoic acid);hydrobromide?
The canonical SMILES for bis((2R)-2-[5-(4-methylpiperazin-1-yl)pentanoylamino]-3-sulfanylpropanoic acid);hydrobromide is Br.CN1CCN(CCCCC(=O)N[C@@H](CS)C(=O)O)CC1.CN1CCN(CCCCC(=O)N[C@@H](CS)C(=O)O)CC1.
What is the InChIKey of bis((2R)-2-[5-(4-methylpiperazin-1-yl)pentanoylamino]-3-sulfanylpropanoic acid);hydrobromide?
The InChIKey is XYHILFGWSXSRDN-ISAZSYCMSA-N. The full InChI is InChI=1S/2C13H25N3O3S.BrH/c2*1-15-6-8-16(9-7-15)5-3-2-4-12(17)14-11(10-20)13(18)19;/h2*11,20H,2-10H2,1H3,(H,14,17)(H,18,19);1H/t2*11-;/m00./s1.
What are the key properties of bis((2R)-2-[5-(4-methylpiperazin-1-yl)pentanoylamino]-3-sulfanylpropanoic acid);hydrobromide?
bis((2R)-2-[5-(4-methylpiperazin-1-yl)pentanoylamino]-3-sulfanylpropanoic acid);hydrobromide has a molecular weight of 687.77 g/mol, XLogP of 0.38, 16 rotatable bonds, 6 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for bis((2R)-2-[5-(4-methylpiperazin-1-yl)pentanoylamino]-3-sulfanylpropanoic acid);hydrobromide is sourced from PubChem (CID 24952539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).