C18H27N3O5 — CID 154906123
formic acid;(2S)-2-[3-(4-methylpiperazin-1-yl)propanoylamino]-3-phenylpropanoic acid (PubChem CID 154906123) has the molecular formula C18H27N3O5 and a molecular weight of 365.43 g/mol. Its IUPAC name is formic acid;(2S)-2-[3-(4-methylpiperazin-1-yl)propanoylamino]-3-phenylpropanoic acid.
| Compound Name | formic acid;(2S)-2-[3-(4-methylpiperazin-1-yl)propanoylamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 154906123 |
| Molecular Formula | C18H27N3O5 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | formic acid;(2S)-2-[3-(4-methylpiperazin-1-yl)propanoylamino]-3-phenylpropanoic acid |
| SMILES | CN1CCN(CCC(=O)N[C@@H](Cc2ccccc2)C(=O)O)CC1.O=CO |
| InChI | InChI=1S/C17H25N3O3.CH2O2/c1-19-9-11-20(12-10-19)8-7-16(21)18-15(17(22)23)13-14-5-3-2-4-6-14;2-1-3/h2-6,15H,7-13H2,1H3,(H,18,21)(H,22,23);1H,(H,2,3)/t15-;/m0./s1 |
| InChIKey | BBEBDPUXMNJCIJ-RSAXXLAASA-N |
| XLogP | 0.14 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|