C3H8NO5PS — CID 54499104
(2R)-2-(phosphonoamino)-3-sulfanylpropanoic acid (PubChem CID 54499104) has the molecular formula C3H8NO5PS and a molecular weight of 201.14 g/mol. Its IUPAC name is (2R)-2-(phosphonoamino)-3-sulfanylpropanoic acid.
| Compound Name | (2R)-2-(phosphonoamino)-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 54499104 |
| Molecular Formula | C3H8NO5PS |
| Molecular Weight | 201.14 g/mol |
| Exact Mass | 200.99 |
| IUPAC Name | (2R)-2-(phosphonoamino)-3-sulfanylpropanoic acid |
| SMILES | O=C(O)[C@H](CS)NP(=O)(O)O |
| InChI | InChI=1S/C3H8NO5PS/c5-3(6)2(1-11)4-10(7,8)9/h2,11H,1H2,(H,5,6)(H3,4,7,8,9)/t2-/m0/s1 |
| InChIKey | YBEPDTOTOCUWHF-REOHCLBHSA-N |
| XLogP | -0.95 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.14 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|