C5H12NO5PS — CID 140728377
(2S)-4-methylsulfanyl-2-(phosphonoamino)butanoic acid (PubChem CID 140728377) has the molecular formula C5H12NO5PS and a molecular weight of 229.19 g/mol. Its IUPAC name is (2S)-4-methylsulfanyl-2-(phosphonoamino)butanoic acid.
| Compound Name | (2S)-4-methylsulfanyl-2-(phosphonoamino)butanoic acid |
|---|---|
| PubChem CID | 140728377 |
| Molecular Formula | C5H12NO5PS |
| Molecular Weight | 229.19 g/mol |
| Exact Mass | 229.02 |
| IUPAC Name | (2S)-4-methylsulfanyl-2-(phosphonoamino)butanoic acid |
| SMILES | CSCC[C@H](NP(=O)(O)O)C(=O)O |
| InChI | InChI=1S/C5H12NO5PS/c1-13-3-2-4(5(7)8)6-12(9,10)11/h4H,2-3H2,1H3,(H,7,8)(H3,6,9,10,11)/t4-/m0/s1 |
| InChIKey | HKUBRVXEDUDEKT-BYPYZUCNSA-N |
| XLogP | -0.12 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.19 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|