C14H26N4O6S2 — CID 87760899
N,N'-bis[1-(2-hydroxypropylamino)-1-oxo-3-sulfanylpropan-2-yl]oxamide (PubChem CID 87760899) has the molecular formula C14H26N4O6S2 and a molecular weight of 410.52 g/mol. Its IUPAC name is N,N'-bis[1-(2-hydroxypropylamino)-1-oxo-3-sulfanylpropan-2-yl]oxamide.
| Compound Name | N,N'-bis[1-(2-hydroxypropylamino)-1-oxo-3-sulfanylpropan-2-yl]oxamide |
|---|---|
| PubChem CID | 87760899 |
| Molecular Formula | C14H26N4O6S2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | N,N'-bis[1-(2-hydroxypropylamino)-1-oxo-3-sulfanylpropan-2-yl]oxamide |
| SMILES | CC(O)CNC(=O)C(CS)NC(=O)C(=O)NC(CS)C(=O)NCC(C)O |
| InChI | InChI=1S/C14H26N4O6S2/c1-7(19)3-15-11(21)9(5-25)17-13(23)14(24)18-10(6-26)12(22)16-4-8(2)20/h7-10,19-20,25-26H,3-6H2,1-2H3,(H,15,21)(H,16,22)(H,17,23)(H,18,24) |
| InChIKey | JJXXNIWIIMCQGQ-UHFFFAOYSA-N |
| XLogP | -3.19 |
| TPSA | 156.86 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | -3.19 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|