C11H22N2O3S — CID 107769713
2-acetamido-N-(2-ethyl-4-hydroxybutyl)-3-sulfanylpropanamide (PubChem CID 107769713) has the molecular formula C11H22N2O3S and a molecular weight of 262.37 g/mol. Its IUPAC name is 2-acetamido-N-(2-ethyl-4-hydroxybutyl)-3-sulfanylpropanamide.
| Compound Name | 2-acetamido-N-(2-ethyl-4-hydroxybutyl)-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 107769713 |
| Molecular Formula | C11H22N2O3S |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 2-acetamido-N-(2-ethyl-4-hydroxybutyl)-3-sulfanylpropanamide |
| SMILES | CCC(CCO)CNC(=O)C(CS)NC(C)=O |
| InChI | InChI=1S/C11H22N2O3S/c1-3-9(4-5-14)6-12-11(16)10(7-17)13-8(2)15/h9-10,14,17H,3-7H2,1-2H3,(H,12,16)(H,13,15) |
| InChIKey | CDFGJJKZXPTRDQ-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|