C20H40N2O4S — CID 146614119
2-[[(2R)-2-amino-3-pentadecan-8-ylsulfinylpropanoyl]amino]acetic acid (PubChem CID 146614119) has the molecular formula C20H40N2O4S and a molecular weight of 404.62 g/mol. Its IUPAC name is 2-[[(2R)-2-amino-3-pentadecan-8-ylsulfinylpropanoyl]amino]acetic acid.
| Compound Name | 2-[[(2R)-2-amino-3-pentadecan-8-ylsulfinylpropanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 146614119 |
| Molecular Formula | C20H40N2O4S |
| Molecular Weight | 404.62 g/mol |
| Exact Mass | 404.27 |
| IUPAC Name | 2-[[(2R)-2-amino-3-pentadecan-8-ylsulfinylpropanoyl]amino]acetic acid |
| SMILES | CCCCCCCC(CCCCCCC)S(=O)C[C@H](N)C(=O)NCC(=O)O |
| InChI | InChI=1S/C20H40N2O4S/c1-3-5-7-9-11-13-17(14-12-10-8-6-4-2)27(26)16-18(21)20(25)22-15-19(23)24/h17-18H,3-16,21H2,1-2H3,(H,22,25)(H,23,24)/t18-,27?/m0/s1 |
| InChIKey | VLQGDTQVDIGGQX-HSYKDVHTSA-N |
| XLogP | 3.35 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.62 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|