C23H37N3O4 — CID 10251523
2-[[(2R)-2-amino-6-[(4-octylbenzoyl)amino]hexanoyl]amino]acetic acid (PubChem CID 10251523) has the molecular formula C23H37N3O4 and a molecular weight of 419.57 g/mol. Its IUPAC name is 2-[[(2R)-2-amino-6-[(4-octylbenzoyl)amino]hexanoyl]amino]acetic acid.
| Compound Name | 2-[[(2R)-2-amino-6-[(4-octylbenzoyl)amino]hexanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 10251523 |
| Molecular Formula | C23H37N3O4 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.28 |
| IUPAC Name | 2-[[(2R)-2-amino-6-[(4-octylbenzoyl)amino]hexanoyl]amino]acetic acid |
| SMILES | CCCCCCCCc1ccc(C(=O)NCCCC[C@@H](N)C(=O)NCC(=O)O)cc1 |
| InChI | InChI=1S/C23H37N3O4/c1-2-3-4-5-6-7-10-18-12-14-19(15-13-18)22(29)25-16-9-8-11-20(24)23(30)26-17-21(27)28/h12-15,20H,2-11,16-17,24H2,1H3,(H,25,29)(H,26,30)(H,27,28)/t20-/m1/s1 |
| InChIKey | LNTKNHBUBBOYHN-HXUWFJFHSA-N |
| XLogP | 3.02 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|