C20H31N4O2Rb — CID 171639673
[4-[[(5R)-5-amino-6-(hex-5-enylamino)-6-oxohexyl]carbamoyl]phenyl]methylazanide;rubidium(1+) (PubChem CID 171639673) has the molecular formula C20H31N4O2Rb and a molecular weight of 444.96 g/mol. Its IUPAC name is [4-[[(5R)-5-amino-6-(hex-5-enylamino)-6-oxohexyl]carbamoyl]phenyl]methylazanide;rubidium(1+).
| Compound Name | [4-[[(5R)-5-amino-6-(hex-5-enylamino)-6-oxohexyl]carbamoyl]phenyl]methylazanide;rubidium(1+) |
|---|---|
| PubChem CID | 171639673 |
| Molecular Formula | C20H31N4O2Rb |
| Molecular Weight | 444.96 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | [4-[[(5R)-5-amino-6-(hex-5-enylamino)-6-oxohexyl]carbamoyl]phenyl]methylazanide;rubidium(1+) |
| SMILES | C=CCCCCNC(=O)[C@H](N)CCCCNC(=O)c1ccc(C[NH-])cc1.[Rb+] |
| InChI | InChI=1S/C20H31N4O2.Rb/c1-2-3-4-6-13-24-20(26)18(22)8-5-7-14-23-19(25)17-11-9-16(15-21)10-12-17;/h2,9-12,18,21H,1,3-8,13-15,22H2,(H,23,25)(H,24,26);/q-1;+1/t18-;/m1./s1 |
| InChIKey | LAJZHCZXPAEPGW-GMUIIQOCSA-N |
| XLogP | -0.06 |
| TPSA | 108.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.96 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|