C18H28N3O2Rb — CID 171640058
4-[[4-(4-methylpentylcarbamoyl)benzoyl]amino]butylazanide;rubidium(1+) (PubChem CID 171640058) has the molecular formula C18H28N3O2Rb and a molecular weight of 403.91 g/mol. Its IUPAC name is 4-[[4-(4-methylpentylcarbamoyl)benzoyl]amino]butylazanide;rubidium(1+).
| Compound Name | 4-[[4-(4-methylpentylcarbamoyl)benzoyl]amino]butylazanide;rubidium(1+) |
|---|---|
| PubChem CID | 171640058 |
| Molecular Formula | C18H28N3O2Rb |
| Molecular Weight | 403.91 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | 4-[[4-(4-methylpentylcarbamoyl)benzoyl]amino]butylazanide;rubidium(1+) |
| SMILES | CC(C)CCCNC(=O)c1ccc(C(=O)NCCCC[NH-])cc1.[Rb+] |
| InChI | InChI=1S/C18H28N3O2.Rb/c1-14(2)6-5-13-21-18(23)16-9-7-15(8-10-16)17(22)20-12-4-3-11-19;/h7-10,14,19H,3-6,11-13H2,1-2H3,(H,20,22)(H,21,23);/q-1;+1 |
| InChIKey | UWJIVUBRKBXNHK-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.91 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|