C15H25NO2Si — CID 157299766
4-[hydroxy(dimethyl)silyl]-N-(4-methylpentyl)benzamide (PubChem CID 157299766) has the molecular formula C15H25NO2Si and a molecular weight of 279.46 g/mol. Its IUPAC name is 4-[hydroxy(dimethyl)silyl]-N-(4-methylpentyl)benzamide.
| Compound Name | 4-[hydroxy(dimethyl)silyl]-N-(4-methylpentyl)benzamide |
|---|---|
| PubChem CID | 157299766 |
| Molecular Formula | C15H25NO2Si |
| Molecular Weight | 279.46 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | 4-[hydroxy(dimethyl)silyl]-N-(4-methylpentyl)benzamide |
| SMILES | CC(C)CCCNC(=O)c1ccc([Si](C)(C)O)cc1 |
| InChI | InChI=1S/C15H25NO2Si/c1-12(2)6-5-11-16-15(17)13-7-9-14(10-8-13)19(3,4)18/h7-10,12,18H,5-6,11H2,1-4H3,(H,16,17) |
| InChIKey | BBTMTENIEAXSNS-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.46 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|