C37H62N8O9 — CID 171757894
2-[4-[2-[[4-[[(5R)-5-amino-6-(5-methylhexylamino)-6-oxohexyl]carbamoyl]phenyl]methylamino]-2-oxoethyl]-7,10-bis(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 171757894) has the molecular formula C37H62N8O9 and a molecular weight of 762.95 g/mol. Its IUPAC name is 2-[4-[2-[[4-[[(5R)-5-amino-6-(5-methylhexylamino)-6-oxohexyl]carbamoyl]phenyl]methylamino]-2-oxoethyl]-7,10-bis(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4-[2-[[4-[[(5R)-5-amino-6-(5-methylhexylamino)-6-oxohexyl]carbamoyl]phenyl]methylamino]-2-oxoethyl]-7,10-bis(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 171757894 |
| Molecular Formula | C37H62N8O9 |
| Molecular Weight | 762.95 g/mol |
| Exact Mass | 762.46 |
| IUPAC Name | 2-[4-[2-[[4-[[(5R)-5-amino-6-(5-methylhexylamino)-6-oxohexyl]carbamoyl]phenyl]methylamino]-2-oxoethyl]-7,10-bis(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | CC(C)CCCCNC(=O)[C@H](N)CCCCNC(=O)c1ccc(CNC(=O)CN2CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC2)cc1 |
| InChI | InChI=1S/C37H62N8O9/c1-28(2)7-3-5-14-40-37(54)31(38)8-4-6-13-39-36(53)30-11-9-29(10-12-30)23-41-32(46)24-42-15-17-43(25-33(47)48)19-21-45(27-35(51)52)22-20-44(18-16-42)26-34(49)50/h9-12,28,31H,3-8,13-27,38H2,1-2H3,(H,39,53)(H,40,54)(H,41,46)(H,47,48)(H,49,50)(H,51,52)/t31-/m1/s1 |
| InChIKey | ZCKJWAONTNDCAC-WJOKGBTCSA-N |
| XLogP | -0.05 |
| TPSA | 238.18 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.95 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|