C30H49N7O7 — CID 88984802
2-[4-[2-[[4-[[[(2R)-2-amino-4-methylpentanoyl]amino]oxymethyl]phenyl]methylamino]-2-oxoethyl]-7,10-bis(2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 88984802) has the molecular formula C30H49N7O7 and a molecular weight of 619.76 g/mol. Its IUPAC name is 2-[4-[2-[[4-[[[(2R)-2-amino-4-methylpentanoyl]amino]oxymethyl]phenyl]methylamino]-2-oxoethyl]-7,10-bis(2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4-[2-[[4-[[[(2R)-2-amino-4-methylpentanoyl]amino]oxymethyl]phenyl]methylamino]-2-oxoethyl]-7,10-bis(2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 88984802 |
| Molecular Formula | C30H49N7O7 |
| Molecular Weight | 619.76 g/mol |
| Exact Mass | 619.37 |
| IUPAC Name | 2-[4-[2-[[4-[[[(2R)-2-amino-4-methylpentanoyl]amino]oxymethyl]phenyl]methylamino]-2-oxoethyl]-7,10-bis(2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | CC(C)C[C@@H](N)C(=O)NOCc1ccc(CNC(=O)CN2CCN(CC=O)CCN(CC=O)CCN(CC(=O)O)CC2)cc1 |
| InChI | InChI=1S/C30H49N7O7/c1-24(2)19-27(31)30(43)33-44-23-26-5-3-25(4-6-26)20-32-28(40)21-36-11-9-34(15-17-38)7-8-35(16-18-39)10-12-37(14-13-36)22-29(41)42/h3-6,17-18,24,27H,7-16,19-23,31H2,1-2H3,(H,32,40)(H,33,43)(H,41,42)/t27-/m1/s1 |
| InChIKey | GBIGPLFSAKNQSE-HHHXNRCGSA-N |
| XLogP | -1.07 |
| TPSA | 177.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.76 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|