C33H53N7O10 — CID 177166989
2-[4-[2-[[4-[2-[3-(butylamino)-3-oxopropoxy]ethylcarbamoyl]phenyl]methylamino]-2-oxoethyl]-7,10-bis(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 177166989) has the molecular formula C33H53N7O10 and a molecular weight of 707.83 g/mol. Its IUPAC name is 2-[4-[2-[[4-[2-[3-(butylamino)-3-oxopropoxy]ethylcarbamoyl]phenyl]methylamino]-2-oxoethyl]-7,10-bis(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4-[2-[[4-[2-[3-(butylamino)-3-oxopropoxy]ethylcarbamoyl]phenyl]methylamino]-2-oxoethyl]-7,10-bis(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 177166989 |
| Molecular Formula | C33H53N7O10 |
| Molecular Weight | 707.83 g/mol |
| Exact Mass | 707.39 |
| IUPAC Name | 2-[4-[2-[[4-[2-[3-(butylamino)-3-oxopropoxy]ethylcarbamoyl]phenyl]methylamino]-2-oxoethyl]-7,10-bis(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | CCCCNC(=O)CCOCCNC(=O)c1ccc(CNC(=O)CN2CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC2)cc1 |
| InChI | InChI=1S/C33H53N7O10/c1-2-3-9-34-28(41)8-19-50-20-10-35-33(49)27-6-4-26(5-7-27)21-36-29(42)22-37-11-13-38(23-30(43)44)15-17-40(25-32(47)48)18-16-39(14-12-37)24-31(45)46/h4-7H,2-3,8-25H2,1H3,(H,34,41)(H,35,49)(H,36,42)(H,43,44)(H,45,46)(H,47,48) |
| InChIKey | XUSWLWSALIEIEL-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 221.39 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.83 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|