C27H38N2O4 — CID 170597223
4-[(butanoylamino)methyl]-N-[2-[2-(4-butyl-2-methoxyphenyl)ethoxy]ethyl]benzamide (PubChem CID 170597223) has the molecular formula C27H38N2O4 and a molecular weight of 454.61 g/mol. Its IUPAC name is 4-[(butanoylamino)methyl]-N-[2-[2-(4-butyl-2-methoxyphenyl)ethoxy]ethyl]benzamide.
| Compound Name | 4-[(butanoylamino)methyl]-N-[2-[2-(4-butyl-2-methoxyphenyl)ethoxy]ethyl]benzamide |
|---|---|
| PubChem CID | 170597223 |
| Molecular Formula | C27H38N2O4 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.28 |
| IUPAC Name | 4-[(butanoylamino)methyl]-N-[2-[2-(4-butyl-2-methoxyphenyl)ethoxy]ethyl]benzamide |
| SMILES | CCCCc1ccc(CCOCCNC(=O)c2ccc(CNC(=O)CCC)cc2)c(OC)c1 |
| InChI | InChI=1S/C27H38N2O4/c1-4-6-8-21-9-12-23(25(19-21)32-3)15-17-33-18-16-28-27(31)24-13-10-22(11-14-24)20-29-26(30)7-5-2/h9-14,19H,4-8,15-18,20H2,1-3H3,(H,28,31)(H,29,30) |
| InChIKey | SDHDVPOKHBGDGO-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|