C24H32ClNO3 — CID 178062536
N-[2-[2-[4-(3-chloropropyl)-2-methoxyphenyl]ethoxy]ethyl]-4-propan-2-ylbenzamide (PubChem CID 178062536) has the molecular formula C24H32ClNO3 and a molecular weight of 417.98 g/mol. Its IUPAC name is N-[2-[2-[4-(3-chloropropyl)-2-methoxyphenyl]ethoxy]ethyl]-4-propan-2-ylbenzamide.
| Compound Name | N-[2-[2-[4-(3-chloropropyl)-2-methoxyphenyl]ethoxy]ethyl]-4-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 178062536 |
| Molecular Formula | C24H32ClNO3 |
| Molecular Weight | 417.98 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | N-[2-[2-[4-(3-chloropropyl)-2-methoxyphenyl]ethoxy]ethyl]-4-propan-2-ylbenzamide |
| SMILES | COc1cc(CCCCl)ccc1CCOCCNC(=O)c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C24H32ClNO3/c1-18(2)20-8-10-22(11-9-20)24(27)26-14-16-29-15-12-21-7-6-19(5-4-13-25)17-23(21)28-3/h6-11,17-18H,4-5,12-16H2,1-3H3,(H,26,27) |
| InChIKey | GQYGWSNOGFDJLM-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.98 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|