C25H36ClNO3 — CID 178062532
N-[2-[2-[4-(3-chloropropyl)-2-methoxyphenyl]ethoxy]ethyl]formamide;1-methyl-4-propan-2-ylbenzene (PubChem CID 178062532) has the molecular formula C25H36ClNO3 and a molecular weight of 434.02 g/mol. Its IUPAC name is N-[2-[2-[4-(3-chloropropyl)-2-methoxyphenyl]ethoxy]ethyl]formamide;1-methyl-4-propan-2-ylbenzene.
| Compound Name | N-[2-[2-[4-(3-chloropropyl)-2-methoxyphenyl]ethoxy]ethyl]formamide;1-methyl-4-propan-2-ylbenzene |
|---|---|
| PubChem CID | 178062532 |
| Molecular Formula | C25H36ClNO3 |
| Molecular Weight | 434.02 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | N-[2-[2-[4-(3-chloropropyl)-2-methoxyphenyl]ethoxy]ethyl]formamide;1-methyl-4-propan-2-ylbenzene |
| SMILES | COc1cc(CCCCl)ccc1CCOCCNC=O.Cc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C15H22ClNO3.C10H14/c1-19-15-11-13(3-2-7-16)4-5-14(15)6-9-20-10-8-17-12-18;1-8(2)10-6-4-9(3)5-7-10/h4-5,11-12H,2-3,6-10H2,1H3,(H,17,18);4-8H,1-3H3 |
| InChIKey | YPZXMFAEIQLUGG-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.02 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|