C16H25NO5S — CID 142403236
N-[2-[2-[2-[2-(4-methylphenyl)sulfanyloxyethoxy]ethoxy]ethoxy]ethyl]formamide (PubChem CID 142403236) has the molecular formula C16H25NO5S and a molecular weight of 343.44 g/mol. Its IUPAC name is N-[2-[2-[2-[2-(4-methylphenyl)sulfanyloxyethoxy]ethoxy]ethoxy]ethyl]formamide.
| Compound Name | N-[2-[2-[2-[2-(4-methylphenyl)sulfanyloxyethoxy]ethoxy]ethoxy]ethyl]formamide |
|---|---|
| PubChem CID | 142403236 |
| Molecular Formula | C16H25NO5S |
| Molecular Weight | 343.44 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | N-[2-[2-[2-[2-(4-methylphenyl)sulfanyloxyethoxy]ethoxy]ethoxy]ethyl]formamide |
| SMILES | Cc1ccc(SOCCOCCOCCOCCNC=O)cc1 |
| InChI | InChI=1S/C16H25NO5S/c1-15-2-4-16(5-3-15)23-22-13-12-21-11-10-20-9-8-19-7-6-17-14-18/h2-5,14H,6-13H2,1H3,(H,17,18) |
| InChIKey | VYDNRZGLWJAWLZ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.44 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|