C11H16O3S — CID 142608079
2-[2-(4-methylphenyl)sulfanyloxyethoxy]ethanol (PubChem CID 142608079) has the molecular formula C11H16O3S and a molecular weight of 228.31 g/mol. Its IUPAC name is 2-[2-(4-methylphenyl)sulfanyloxyethoxy]ethanol.
| Compound Name | 2-[2-(4-methylphenyl)sulfanyloxyethoxy]ethanol |
|---|---|
| PubChem CID | 142608079 |
| Molecular Formula | C11H16O3S |
| Molecular Weight | 228.31 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 2-[2-(4-methylphenyl)sulfanyloxyethoxy]ethanol |
| SMILES | Cc1ccc(SOCCOCCO)cc1 |
| InChI | InChI=1S/C11H16O3S/c1-10-2-4-11(5-3-10)15-14-9-8-13-7-6-12/h2-5,12H,6-9H2,1H3 |
| InChIKey | QKRACDMLODHNKE-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.31 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|