C18H29NO3S — CID 170111031
tert-butyl N-[2-methyl-5-(4-methylphenyl)sulfanyloxypentan-2-yl]carbamate (PubChem CID 170111031) has the molecular formula C18H29NO3S and a molecular weight of 339.50 g/mol. Its IUPAC name is tert-butyl N-[2-methyl-5-(4-methylphenyl)sulfanyloxypentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[2-methyl-5-(4-methylphenyl)sulfanyloxypentan-2-yl]carbamate |
|---|---|
| PubChem CID | 170111031 |
| Molecular Formula | C18H29NO3S |
| Molecular Weight | 339.50 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | tert-butyl N-[2-methyl-5-(4-methylphenyl)sulfanyloxypentan-2-yl]carbamate |
| SMILES | Cc1ccc(SOCCCC(C)(C)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C18H29NO3S/c1-14-8-10-15(11-9-14)23-21-13-7-12-18(5,6)19-16(20)22-17(2,3)4/h8-11H,7,12-13H2,1-6H3,(H,19,20) |
| InChIKey | FUYXTEJVTHMVEV-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.50 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|