C25H33O2S3+ — CID 172575708
ethane;2-methyl-4-[2-[2-(4-methylphenyl)sulfanyloxyethoxy]ethyl]-3-[(Z)-prop-1-enyl]-1,4-benzodithiin-4-ium (PubChem CID 172575708) has the molecular formula C25H33O2S3+ and a molecular weight of 461.74 g/mol. Its IUPAC name is ethane;2-methyl-4-[2-[2-(4-methylphenyl)sulfanyloxyethoxy]ethyl]-3-[(Z)-prop-1-enyl]-1,4-benzodithiin-4-ium.
| Compound Name | ethane;2-methyl-4-[2-[2-(4-methylphenyl)sulfanyloxyethoxy]ethyl]-3-[(Z)-prop-1-enyl]-1,4-benzodithiin-4-ium |
|---|---|
| PubChem CID | 172575708 |
| Molecular Formula | C25H33O2S3+ |
| Molecular Weight | 461.74 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | ethane;2-methyl-4-[2-[2-(4-methylphenyl)sulfanyloxyethoxy]ethyl]-3-[(Z)-prop-1-enyl]-1,4-benzodithiin-4-ium |
| SMILES | C/C=C\C1=C(C)Sc2ccccc2[S+]1CCOCCOSc1ccc(C)cc1.CC |
| InChI | InChI=1S/C23H27O2S3.C2H6/c1-4-7-22-19(3)26-21-8-5-6-9-23(21)28(22)17-16-24-14-15-25-27-20-12-10-18(2)11-13-20;1-2/h4-13H,14-17H2,1-3H3;1-2H3/q+1;/b7-4-; |
| InChIKey | HKXUJUKEWFPQAD-ZULQGGHCSA-N |
| XLogP | 7.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.74 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|