C14H27NO6 — CID 166149013
tert-butyl 3-[2-[2-(2-formamidoethoxy)ethoxy]ethoxy]propanoate (PubChem CID 166149013) has the molecular formula C14H27NO6 and a molecular weight of 305.37 g/mol. Its IUPAC name is tert-butyl 3-[2-[2-(2-formamidoethoxy)ethoxy]ethoxy]propanoate.
| Compound Name | tert-butyl 3-[2-[2-(2-formamidoethoxy)ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 166149013 |
| Molecular Formula | C14H27NO6 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | tert-butyl 3-[2-[2-(2-formamidoethoxy)ethoxy]ethoxy]propanoate |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCNC=O |
| InChI | InChI=1S/C14H27NO6/c1-14(2,3)21-13(17)4-6-18-8-10-20-11-9-19-7-5-15-12-16/h12H,4-11H2,1-3H3,(H,15,16) |
| InChIKey | IRVSLBDWBGQQFL-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|