C21H36N2O2 — CID 67659751
N-[[4-[2-(dimethylamino)ethyl]-3-methoxyphenyl]methyl]nonanamide (PubChem CID 67659751) has the molecular formula C21H36N2O2 and a molecular weight of 348.53 g/mol. Its IUPAC name is N-[[4-[2-(dimethylamino)ethyl]-3-methoxyphenyl]methyl]nonanamide.
| Compound Name | N-[[4-[2-(dimethylamino)ethyl]-3-methoxyphenyl]methyl]nonanamide |
|---|---|
| PubChem CID | 67659751 |
| Molecular Formula | C21H36N2O2 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.28 |
| IUPAC Name | N-[[4-[2-(dimethylamino)ethyl]-3-methoxyphenyl]methyl]nonanamide |
| SMILES | CCCCCCCCC(=O)NCc1ccc(CCN(C)C)c(OC)c1 |
| InChI | InChI=1S/C21H36N2O2/c1-5-6-7-8-9-10-11-21(24)22-17-18-12-13-19(14-15-23(2)3)20(16-18)25-4/h12-13,16H,5-11,14-15,17H2,1-4H3,(H,22,24) |
| InChIKey | YTFKWKGKAPPYSP-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|