C28H48N2O2S — CID 67825540
(Z)-N-[[4-(2-aminoethylsulfanyl)-3-methoxyphenyl]methyl]octadec-9-enamide (PubChem CID 67825540) has the molecular formula C28H48N2O2S and a molecular weight of 476.77 g/mol. Its IUPAC name is (Z)-N-[[4-(2-aminoethylsulfanyl)-3-methoxyphenyl]methyl]octadec-9-enamide.
| Compound Name | (Z)-N-[[4-(2-aminoethylsulfanyl)-3-methoxyphenyl]methyl]octadec-9-enamide |
|---|---|
| PubChem CID | 67825540 |
| Molecular Formula | C28H48N2O2S |
| Molecular Weight | 476.77 g/mol |
| Exact Mass | 476.34 |
| IUPAC Name | (Z)-N-[[4-(2-aminoethylsulfanyl)-3-methoxyphenyl]methyl]octadec-9-enamide |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)NCc1ccc(SCCN)c(OC)c1 |
| InChI | InChI=1S/C28H48N2O2S/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-28(31)30-24-25-19-20-27(33-22-21-29)26(23-25)32-2/h10-11,19-20,23H,3-9,12-18,21-22,24,29H2,1-2H3,(H,30,31)/b11-10- |
| InChIKey | UEWUOPBFWCHZDJ-KHPPLWFESA-N |
| XLogP | 7.40 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.77 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|