C34H47N11O5S — CID 122698152
2-[4-[[4-[[5-amino-6-[[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenyl]methylamino]-6-oxohexyl]carbamothioylamino]phenyl]methyl]-7-(carboxymethyl)-1,4,7-triazonan-1-yl]acetic acid (PubChem CID 122698152) has the molecular formula C34H47N11O5S and a molecular weight of 721.89 g/mol. Its IUPAC name is 2-[4-[[4-[[5-amino-6-[[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenyl]methylamino]-6-oxohexyl]carbamothioylamino]phenyl]methyl]-7-(carboxymethyl)-1,4,7-triazonan-1-yl]acetic acid.
| Compound Name | 2-[4-[[4-[[5-amino-6-[[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenyl]methylamino]-6-oxohexyl]carbamothioylamino]phenyl]methyl]-7-(carboxymethyl)-1,4,7-triazonan-1-yl]acetic acid |
|---|---|
| PubChem CID | 122698152 |
| Molecular Formula | C34H47N11O5S |
| Molecular Weight | 721.89 g/mol |
| Exact Mass | 721.35 |
| IUPAC Name | 2-[4-[[4-[[5-amino-6-[[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenyl]methylamino]-6-oxohexyl]carbamothioylamino]phenyl]methyl]-7-(carboxymethyl)-1,4,7-triazonan-1-yl]acetic acid |
| SMILES | Cc1nnc(-c2ccc(CNC(=O)C(N)CCCCNC(=S)Nc3ccc(CN4CCN(CC(=O)O)CCN(CC(=O)O)CC4)cc3)cc2)nn1 |
| InChI | InChI=1S/C34H47N11O5S/c1-24-39-41-32(42-40-24)27-9-5-25(6-10-27)20-37-33(50)29(35)4-2-3-13-36-34(51)38-28-11-7-26(8-12-28)21-43-14-16-44(22-30(46)47)18-19-45(17-15-43)23-31(48)49/h5-12,29H,2-4,13-23,35H2,1H3,(H,37,50)(H,46,47)(H,48,49)(H2,36,38,51) |
| InChIKey | KXJZJDCNFIPZKA-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 215.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.89 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|