C13H19N3O5S — CID 146417937
[4-[[[(2S)-2-amino-4-methylsulfonylbutanoyl]amino]methyl]phenyl]carbamic acid (PubChem CID 146417937) has the molecular formula C13H19N3O5S and a molecular weight of 329.38 g/mol. Its IUPAC name is [4-[[[(2S)-2-amino-4-methylsulfonylbutanoyl]amino]methyl]phenyl]carbamic acid.
| Compound Name | [4-[[[(2S)-2-amino-4-methylsulfonylbutanoyl]amino]methyl]phenyl]carbamic acid |
|---|---|
| PubChem CID | 146417937 |
| Molecular Formula | C13H19N3O5S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | [4-[[[(2S)-2-amino-4-methylsulfonylbutanoyl]amino]methyl]phenyl]carbamic acid |
| SMILES | CS(=O)(=O)CC[C@H](N)C(=O)NCc1ccc(NC(=O)O)cc1 |
| InChI | InChI=1S/C13H19N3O5S/c1-22(20,21)7-6-11(14)12(17)15-8-9-2-4-10(5-3-9)16-13(18)19/h2-5,11,16H,6-8,14H2,1H3,(H,15,17)(H,18,19)/t11-/m0/s1 |
| InChIKey | JWNDMQNWCOEYCZ-NSHDSACASA-N |
| XLogP | 0.15 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |