C10H18N4O3S — CID 82881520
2-amino-N-[(1-methylpyrazol-3-yl)methyl]-4-methylsulfonylbutanamide (PubChem CID 82881520) has the molecular formula C10H18N4O3S and a molecular weight of 274.35 g/mol. Its IUPAC name is 2-amino-N-[(1-methylpyrazol-3-yl)methyl]-4-methylsulfonylbutanamide.
| Compound Name | 2-amino-N-[(1-methylpyrazol-3-yl)methyl]-4-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 82881520 |
| Molecular Formula | C10H18N4O3S |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 2-amino-N-[(1-methylpyrazol-3-yl)methyl]-4-methylsulfonylbutanamide |
| SMILES | Cn1ccc(CNC(=O)C(N)CCS(C)(=O)=O)n1 |
| InChI | InChI=1S/C10H18N4O3S/c1-14-5-3-8(13-14)7-12-10(15)9(11)4-6-18(2,16)17/h3,5,9H,4,6-7,11H2,1-2H3,(H,12,15) |
| InChIKey | QGWATRDVEZETMS-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |