C17H22N6O2 — CID 118351632
N-(5-amino-6-oxoheptyl)-4-(6-methyl-1,2,4,5-tetrazin-3-yl)benzamide (PubChem CID 118351632) has the molecular formula C17H22N6O2 and a molecular weight of 342.40 g/mol. Its IUPAC name is N-(5-amino-6-oxoheptyl)-4-(6-methyl-1,2,4,5-tetrazin-3-yl)benzamide.
| Compound Name | N-(5-amino-6-oxoheptyl)-4-(6-methyl-1,2,4,5-tetrazin-3-yl)benzamide |
|---|---|
| PubChem CID | 118351632 |
| Molecular Formula | C17H22N6O2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | N-(5-amino-6-oxoheptyl)-4-(6-methyl-1,2,4,5-tetrazin-3-yl)benzamide |
| SMILES | CC(=O)C(N)CCCCNC(=O)c1ccc(-c2nnc(C)nn2)cc1 |
| InChI | InChI=1S/C17H22N6O2/c1-11(24)15(18)5-3-4-10-19-17(25)14-8-6-13(7-9-14)16-22-20-12(2)21-23-16/h6-9,15H,3-5,10,18H2,1-2H3,(H,19,25) |
| InChIKey | GRYXEJGGORJMAN-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 123.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|