About benzene;N-(1-hydroxybutyl)prop-2-enamide;phenol
benzene;N-(1-hydroxybutyl)prop-2-enamide;phenol (PubChem CID 174886545) has the molecular formula C19H25NO3
and a molecular weight of 315.41 g/mol. Its IUPAC name is benzene;N-(1-hydroxybutyl)prop-2-enamide;phenol.
Molecular Properties
| Compound Name | benzene;N-(1-hydroxybutyl)prop-2-enamide;phenol |
| PubChem CID | 174886545 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | benzene;N-(1-hydroxybutyl)prop-2-enamide;phenol |
| SMILES | C=CC(=O)NC(O)CCC.Oc1ccccc1.c1ccccc1 |
| InChI | InChI=1S/C7H13NO2.C6H6O.C6H6/c1-3-5-7(10)8-6(9)4-2;7-6-4-2-1-3-5-6;1-2-4-6-5-3-1/h4,7,10H,2-3,5H2,1H3,(H,8,9);1-5,7H;1-6H |
| InChIKey | MNEAOLPMNZGHDG-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze benzene;N-(1-hydroxybutyl)prop-2-enamide;phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;N-(1-hydroxybutyl)prop-2-enamide;phenol?
The IUPAC name of benzene;N-(1-hydroxybutyl)prop-2-enamide;phenol (CID 174886545) is benzene;N-(1-hydroxybutyl)prop-2-enamide;phenol.
What is the SMILES notation for benzene;N-(1-hydroxybutyl)prop-2-enamide;phenol?
The canonical SMILES for benzene;N-(1-hydroxybutyl)prop-2-enamide;phenol is C=CC(=O)NC(O)CCC.Oc1ccccc1.c1ccccc1.
What is the InChIKey of benzene;N-(1-hydroxybutyl)prop-2-enamide;phenol?
The InChIKey is MNEAOLPMNZGHDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2.C6H6O.C6H6/c1-3-5-7(10)8-6(9)4-2;7-6-4-2-1-3-5-6;1-2-4-6-5-3-1/h4,7,10H,2-3,5H2,1H3,(H,8,9);1-5,7H;1-6H.
What are the key properties of benzene;N-(1-hydroxybutyl)prop-2-enamide;phenol?
benzene;N-(1-hydroxybutyl)prop-2-enamide;phenol has a molecular weight of 315.41 g/mol, XLogP of 3.49, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;N-(1-hydroxybutyl)prop-2-enamide;phenol is sourced from PubChem (CID 174886545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).