C18H28N2O — CID 91423173
N-[(dibutylamino)-phenylmethyl]prop-2-enamide (PubChem CID 91423173) has the molecular formula C18H28N2O and a molecular weight of 288.44 g/mol. Its IUPAC name is N-[(dibutylamino)-phenylmethyl]prop-2-enamide.
| Compound Name | N-[(dibutylamino)-phenylmethyl]prop-2-enamide |
|---|---|
| PubChem CID | 91423173 |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | N-[(dibutylamino)-phenylmethyl]prop-2-enamide |
| SMILES | C=CC(=O)NC(c1ccccc1)N(CCCC)CCCC |
| InChI | InChI=1S/C18H28N2O/c1-4-7-14-20(15-8-5-2)18(19-17(21)6-3)16-12-10-9-11-13-16/h6,9-13,18H,3-5,7-8,14-15H2,1-2H3,(H,19,21) |
| InChIKey | KVQAFNSCARSIDV-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|