C23H33ClN2O — CID 3027044
N-[2-(dibutylamino)-1-phenylethyl]benzamide;hydrochloride (PubChem CID 3027044) has the molecular formula C23H33ClN2O and a molecular weight of 388.98 g/mol. Its IUPAC name is N-[2-(dibutylamino)-1-phenylethyl]benzamide;hydrochloride.
| Compound Name | N-[2-(dibutylamino)-1-phenylethyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 3027044 |
| Molecular Formula | C23H33ClN2O |
| Molecular Weight | 388.98 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | N-[2-(dibutylamino)-1-phenylethyl]benzamide;hydrochloride |
| SMILES | CCCCN(CCCC)CC(NC(=O)c1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C23H32N2O.ClH/c1-3-5-17-25(18-6-4-2)19-22(20-13-9-7-10-14-20)24-23(26)21-15-11-8-12-16-21;/h7-16,22H,3-6,17-19H2,1-2H3,(H,24,26);1H |
| InChIKey | SNNYSZGEINAMLC-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.98 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |