C7H15NO5 — CID 118983712
(4R)-4-aminooxy-2,3,5-trihydroxyheptanal (PubChem CID 118983712) has the molecular formula C7H15NO5 and a molecular weight of 193.20 g/mol. Its IUPAC name is (4R)-4-aminooxy-2,3,5-trihydroxyheptanal.
| Compound Name | (4R)-4-aminooxy-2,3,5-trihydroxyheptanal |
|---|---|
| PubChem CID | 118983712 |
| Molecular Formula | C7H15NO5 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.10 |
| IUPAC Name | (4R)-4-aminooxy-2,3,5-trihydroxyheptanal |
| SMILES | CCC(O)[C@@H](ON)C(O)C(O)C=O |
| InChI | InChI=1S/C7H15NO5/c1-2-4(10)7(13-8)6(12)5(11)3-9/h3-7,10-12H,2,8H2,1H3/t4?,5?,6?,7-/m1/s1 |
| InChIKey | SETFOGOJLXHZKL-MXFXWPKCSA-N |
| XLogP | -2.06 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|