About dipotassium;3-(dimethylamino)propanenitrile;sulfate
dipotassium;3-(dimethylamino)propanenitrile;sulfate (PubChem CID 174389046) has the molecular formula C5H10K2N2O4S
and a molecular weight of 272.41 g/mol. Its IUPAC name is dipotassium;3-(dimethylamino)propanenitrile;sulfate.
Molecular Properties
| Compound Name | dipotassium;3-(dimethylamino)propanenitrile;sulfate |
| PubChem CID | 174389046 |
| Molecular Formula | C5H10K2N2O4S |
| Molecular Weight | 272.41 g/mol |
| Exact Mass | 271.96 |
| IUPAC Name | dipotassium;3-(dimethylamino)propanenitrile;sulfate |
| SMILES | CN(C)CCC#N.O=S(=O)([O-])[O-].[K+].[K+] |
| InChI | InChI=1S/C5H10N2.2K.H2O4S/c1-7(2)5-3-4-6;;;1-5(2,3)4/h3,5H2,1-2H3;;;(H2,1,2,3,4)/q;2*+1;/p-2 |
| InChIKey | HMUSTJJNZCFNMO-UHFFFAOYSA-L |
| XLogP | -6.87 |
| TPSA | 107.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.41 |
| LogP ≤ 5 | -6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze dipotassium;3-(dimethylamino)propanenitrile;sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipotassium;3-(dimethylamino)propanenitrile;sulfate?
The IUPAC name of dipotassium;3-(dimethylamino)propanenitrile;sulfate (CID 174389046) is dipotassium;3-(dimethylamino)propanenitrile;sulfate.
What is the SMILES notation for dipotassium;3-(dimethylamino)propanenitrile;sulfate?
The canonical SMILES for dipotassium;3-(dimethylamino)propanenitrile;sulfate is CN(C)CCC#N.O=S(=O)([O-])[O-].[K+].[K+].
What is the InChIKey of dipotassium;3-(dimethylamino)propanenitrile;sulfate?
The InChIKey is HMUSTJJNZCFNMO-UHFFFAOYSA-L. The full InChI is InChI=1S/C5H10N2.2K.H2O4S/c1-7(2)5-3-4-6;;;1-5(2,3)4/h3,5H2,1-2H3;;;(H2,1,2,3,4)/q;2*+1;/p-2.
What are the key properties of dipotassium;3-(dimethylamino)propanenitrile;sulfate?
dipotassium;3-(dimethylamino)propanenitrile;sulfate has a molecular weight of 272.41 g/mol, XLogP of -6.87, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dipotassium;3-(dimethylamino)propanenitrile;sulfate is sourced from PubChem (CID 174389046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).