C10H27N3 — CID 172586990
ethane;N,N,3-trimethyl-4-(2-methylhydrazinyl)butan-1-amine (PubChem CID 172586990) has the molecular formula C10H27N3 and a molecular weight of 189.35 g/mol. Its IUPAC name is ethane;N,N,3-trimethyl-4-(2-methylhydrazinyl)butan-1-amine.
| Compound Name | ethane;N,N,3-trimethyl-4-(2-methylhydrazinyl)butan-1-amine |
|---|---|
| PubChem CID | 172586990 |
| Molecular Formula | C10H27N3 |
| Molecular Weight | 189.35 g/mol |
| Exact Mass | 189.22 |
| IUPAC Name | ethane;N,N,3-trimethyl-4-(2-methylhydrazinyl)butan-1-amine |
| SMILES | CC.CNNCC(C)CCN(C)C |
| InChI | InChI=1S/C8H21N3.C2H6/c1-8(7-10-9-2)5-6-11(3)4;1-2/h8-10H,5-7H2,1-4H3;1-2H3 |
| InChIKey | KOISEIBFJXGXAW-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.35 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|